C25H30N4OS — CID 137235575
(6R)-3-hexylsulfanyl-6-(4-propan-2-ylphenyl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one (PubChem CID 137235575) has the molecular formula C25H30N4OS and a molecular weight of 434.61 g/mol. Its IUPAC name is (6R)-3-hexylsulfanyl-6-(4-propan-2-ylphenyl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one.
| Compound Name | (6R)-3-hexylsulfanyl-6-(4-propan-2-ylphenyl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
|---|---|
| PubChem CID | 137235575 |
| Molecular Formula | C25H30N4OS |
| Molecular Weight | 434.61 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | (6R)-3-hexylsulfanyl-6-(4-propan-2-ylphenyl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
| SMILES | CCCCCCSC1=NN2C(=c3ccccc3=N[C@H]2c2ccc(C(C)C)cc2)C(=O)N1 |
| InChI | InChI=1S/C25H30N4OS/c1-4-5-6-9-16-31-25-27-24(30)22-20-10-7-8-11-21(20)26-23(29(22)28-25)19-14-12-18(13-15-19)17(2)3/h7-8,10-15,17,23H,4-6,9,16H2,1-3H3,(H,27,28,30)/t23-/m1/s1 |
| InChIKey | CDRIZWOZFNRCDV-HSZRJFAPSA-N |
| XLogP | 4.27 |
| TPSA | 57.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.61 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|