C31H22N4OS — CID 137235865
(6R)-6-anthracen-9-yl-3-benzylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one (PubChem CID 137235865) has the molecular formula C31H22N4OS and a molecular weight of 498.61 g/mol. Its IUPAC name is (6R)-6-anthracen-9-yl-3-benzylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one.
| Compound Name | (6R)-6-anthracen-9-yl-3-benzylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
|---|---|
| PubChem CID | 137235865 |
| Molecular Formula | C31H22N4OS |
| Molecular Weight | 498.61 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | (6R)-6-anthracen-9-yl-3-benzylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
| SMILES | O=C1NC(SCc2ccccc2)=NN2C1=c1ccccc1=N[C@H]2c1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C31H22N4OS/c36-30-28-25-16-8-9-17-26(25)32-29(35(28)34-31(33-30)37-19-20-10-2-1-3-11-20)27-23-14-6-4-12-21(23)18-22-13-5-7-15-24(22)27/h1-18,29H,19H2,(H,33,34,36)/t29-/m1/s1 |
| InChIKey | HTHALSRQPFVKMJ-GDLZYMKVSA-N |
| XLogP | 5.07 |
| TPSA | 57.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.61 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|