C23H18ClN5O4S — CID 137235964
(6R)-6-[5-(2-chloro-4-nitrophenyl)furan-2-yl]-3-propylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one (PubChem CID 137235964) has the molecular formula C23H18ClN5O4S and a molecular weight of 495.95 g/mol. Its IUPAC name is (6R)-6-[5-(2-chloro-4-nitrophenyl)furan-2-yl]-3-propylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one.
| Compound Name | (6R)-6-[5-(2-chloro-4-nitrophenyl)furan-2-yl]-3-propylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
|---|---|
| PubChem CID | 137235964 |
| Molecular Formula | C23H18ClN5O4S |
| Molecular Weight | 495.95 g/mol |
| Exact Mass | 495.08 |
| IUPAC Name | (6R)-6-[5-(2-chloro-4-nitrophenyl)furan-2-yl]-3-propylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
| SMILES | CCCSC1=NN2C(=c3ccccc3=N[C@H]2c2ccc(-c3ccc([N+](=O)[O-])cc3Cl)o2)C(=O)N1 |
| InChI | InChI=1S/C23H18ClN5O4S/c1-2-11-34-23-26-22(30)20-15-5-3-4-6-17(15)25-21(28(20)27-23)19-10-9-18(33-19)14-8-7-13(29(31)32)12-16(14)24/h3-10,12,21H,2,11H2,1H3,(H,26,27,30)/t21-/m1/s1 |
| InChIKey | UNJGYVBSGHQJGK-OAQYLSRUSA-N |
| XLogP | 3.79 |
| TPSA | 113.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.95 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|