C28H27BrN4O3S — CID 137236078
(6S)-6-(3-bromo-5-methoxy-4-phenylmethoxyphenyl)-3-butylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one (PubChem CID 137236078) has the molecular formula C28H27BrN4O3S and a molecular weight of 579.52 g/mol. Its IUPAC name is (6S)-6-(3-bromo-5-methoxy-4-phenylmethoxyphenyl)-3-butylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one.
| Compound Name | (6S)-6-(3-bromo-5-methoxy-4-phenylmethoxyphenyl)-3-butylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
|---|---|
| PubChem CID | 137236078 |
| Molecular Formula | C28H27BrN4O3S |
| Molecular Weight | 579.52 g/mol |
| Exact Mass | 578.10 |
| IUPAC Name | (6S)-6-(3-bromo-5-methoxy-4-phenylmethoxyphenyl)-3-butylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
| SMILES | CCCCSC1=NN2C(=c3ccccc3=N[C@@H]2c2cc(Br)c(OCc3ccccc3)c(OC)c2)C(=O)N1 |
| InChI | InChI=1S/C28H27BrN4O3S/c1-3-4-14-37-28-31-27(34)24-20-12-8-9-13-22(20)30-26(33(24)32-28)19-15-21(29)25(23(16-19)35-2)36-17-18-10-6-5-7-11-18/h5-13,15-16,26H,3-4,14,17H2,1-2H3,(H,31,32,34)/t26-/m0/s1 |
| InChIKey | KFKCRHARTBBIMW-SANMLTNESA-N |
| XLogP | 4.71 |
| TPSA | 75.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.52 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|