C30H32N4O3S — CID 137236116
(6S)-6-(3-ethoxy-4-phenylmethoxyphenyl)-3-pentylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one (PubChem CID 137236116) has the molecular formula C30H32N4O3S and a molecular weight of 528.68 g/mol. Its IUPAC name is (6S)-6-(3-ethoxy-4-phenylmethoxyphenyl)-3-pentylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one.
| Compound Name | (6S)-6-(3-ethoxy-4-phenylmethoxyphenyl)-3-pentylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
|---|---|
| PubChem CID | 137236116 |
| Molecular Formula | C30H32N4O3S |
| Molecular Weight | 528.68 g/mol |
| Exact Mass | 528.22 |
| IUPAC Name | (6S)-6-(3-ethoxy-4-phenylmethoxyphenyl)-3-pentylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
| SMILES | CCCCCSC1=NN2C(=c3ccccc3=N[C@@H]2c2ccc(OCc3ccccc3)c(OCC)c2)C(=O)N1 |
| InChI | InChI=1S/C30H32N4O3S/c1-3-5-11-18-38-30-32-29(35)27-23-14-9-10-15-24(23)31-28(34(27)33-30)22-16-17-25(26(19-22)36-4-2)37-20-21-12-7-6-8-13-21/h6-10,12-17,19,28H,3-5,11,18,20H2,1-2H3,(H,32,33,35)/t28-/m0/s1 |
| InChIKey | PNNYNZBCRQFWFI-NDEPHWFRSA-N |
| XLogP | 4.73 |
| TPSA | 75.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.68 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|