C20H20N4O4S — CID 137236177
(6R)-3-methylsulfanyl-6-(2,4,6-trimethoxyphenyl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one (PubChem CID 137236177) has the molecular formula C20H20N4O4S and a molecular weight of 412.47 g/mol. Its IUPAC name is (6R)-3-methylsulfanyl-6-(2,4,6-trimethoxyphenyl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one.
| Compound Name | (6R)-3-methylsulfanyl-6-(2,4,6-trimethoxyphenyl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
|---|---|
| PubChem CID | 137236177 |
| Molecular Formula | C20H20N4O4S |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | (6R)-3-methylsulfanyl-6-(2,4,6-trimethoxyphenyl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
| SMILES | COc1cc(OC)c([C@@H]2N=c3ccccc3=C3C(=O)NC(SC)=NN32)c(OC)c1 |
| InChI | InChI=1S/C20H20N4O4S/c1-26-11-9-14(27-2)16(15(10-11)28-3)18-21-13-8-6-5-7-12(13)17-19(25)22-20(29-4)23-24(17)18/h5-10,18H,1-4H3,(H,22,23,25)/t18-/m1/s1 |
| InChIKey | AJFSTHJVHRXIQS-GOSISDBHSA-N |
| XLogP | 1.22 |
| TPSA | 84.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |