C27H25FN4O3S — CID 137236216
(6R)-6-(3,4-diethoxyphenyl)-3-[(2-fluorophenyl)methylsulfanyl]-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one (PubChem CID 137236216) has the molecular formula C27H25FN4O3S and a molecular weight of 504.59 g/mol. Its IUPAC name is (6R)-6-(3,4-diethoxyphenyl)-3-[(2-fluorophenyl)methylsulfanyl]-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one.
| Compound Name | (6R)-6-(3,4-diethoxyphenyl)-3-[(2-fluorophenyl)methylsulfanyl]-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
|---|---|
| PubChem CID | 137236216 |
| Molecular Formula | C27H25FN4O3S |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | (6R)-6-(3,4-diethoxyphenyl)-3-[(2-fluorophenyl)methylsulfanyl]-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
| SMILES | CCOc1ccc([C@@H]2N=c3ccccc3=C3C(=O)NC(SCc4ccccc4F)=NN32)cc1OCC |
| InChI | InChI=1S/C27H25FN4O3S/c1-3-34-22-14-13-17(15-23(22)35-4-2)25-29-21-12-8-6-10-19(21)24-26(33)30-27(31-32(24)25)36-16-18-9-5-7-11-20(18)28/h5-15,25H,3-4,16H2,1-2H3,(H,30,31,33)/t25-/m1/s1 |
| InChIKey | BCFRNOMJKGHUTE-RUZDIDTESA-N |
| XLogP | 3.70 |
| TPSA | 75.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |