C19H19BrN4O2S — CID 137236345
(6R)-10-bromo-6-(furan-2-yl)-3-pentylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one (PubChem CID 137236345) has the molecular formula C19H19BrN4O2S and a molecular weight of 447.36 g/mol. Its IUPAC name is (6R)-10-bromo-6-(furan-2-yl)-3-pentylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one.
| Compound Name | (6R)-10-bromo-6-(furan-2-yl)-3-pentylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
|---|---|
| PubChem CID | 137236345 |
| Molecular Formula | C19H19BrN4O2S |
| Molecular Weight | 447.36 g/mol |
| Exact Mass | 446.04 |
| IUPAC Name | (6R)-10-bromo-6-(furan-2-yl)-3-pentylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
| SMILES | CCCCCSC1=NN2C(=c3cc(Br)ccc3=N[C@H]2c2ccco2)C(=O)N1 |
| InChI | InChI=1S/C19H19BrN4O2S/c1-2-3-4-10-27-19-22-18(25)16-13-11-12(20)7-8-14(13)21-17(24(16)23-19)15-6-5-9-26-15/h5-9,11,17H,2-4,10H2,1H3,(H,22,23,25)/t17-/m1/s1 |
| InChIKey | HZVMWPDDOBBMLW-QGZVFWFLSA-N |
| XLogP | 3.11 |
| TPSA | 70.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.36 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|