C25H20ClFN4O3S — CID 137236455
(6S)-6-(2-chloro-4,5-dimethoxyphenyl)-3-[(2-fluorophenyl)methylsulfanyl]-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one (PubChem CID 137236455) has the molecular formula C25H20ClFN4O3S and a molecular weight of 510.98 g/mol. Its IUPAC name is (6S)-6-(2-chloro-4,5-dimethoxyphenyl)-3-[(2-fluorophenyl)methylsulfanyl]-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one.
| Compound Name | (6S)-6-(2-chloro-4,5-dimethoxyphenyl)-3-[(2-fluorophenyl)methylsulfanyl]-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
|---|---|
| PubChem CID | 137236455 |
| Molecular Formula | C25H20ClFN4O3S |
| Molecular Weight | 510.98 g/mol |
| Exact Mass | 510.09 |
| IUPAC Name | (6S)-6-(2-chloro-4,5-dimethoxyphenyl)-3-[(2-fluorophenyl)methylsulfanyl]-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
| SMILES | COc1cc(Cl)c([C@H]2N=c3ccccc3=C3C(=O)NC(SCc4ccccc4F)=NN32)cc1OC |
| InChI | InChI=1S/C25H20ClFN4O3S/c1-33-20-11-16(17(26)12-21(20)34-2)23-28-19-10-6-4-8-15(19)22-24(32)29-25(30-31(22)23)35-13-14-7-3-5-9-18(14)27/h3-12,23H,13H2,1-2H3,(H,29,30,32)/t23-/m0/s1 |
| InChIKey | KWYGKPZFXPSGSS-QHCPKHFHSA-N |
| XLogP | 3.57 |
| TPSA | 75.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.98 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |