C21H22N4O2S — CID 137236691
(6S)-3-butylsulfanyl-6-(4-methoxyphenyl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one (PubChem CID 137236691) has the molecular formula C21H22N4O2S and a molecular weight of 394.50 g/mol. Its IUPAC name is (6S)-3-butylsulfanyl-6-(4-methoxyphenyl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one.
| Compound Name | (6S)-3-butylsulfanyl-6-(4-methoxyphenyl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
|---|---|
| PubChem CID | 137236691 |
| Molecular Formula | C21H22N4O2S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | (6S)-3-butylsulfanyl-6-(4-methoxyphenyl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
| SMILES | CCCCSC1=NN2C(=c3ccccc3=N[C@@H]2c2ccc(OC)cc2)C(=O)N1 |
| InChI | InChI=1S/C21H22N4O2S/c1-3-4-13-28-21-23-20(26)18-16-7-5-6-8-17(16)22-19(25(18)24-21)14-9-11-15(27-2)12-10-14/h5-12,19H,3-4,13H2,1-2H3,(H,23,24,26)/t19-/m0/s1 |
| InChIKey | VNKHGXABJXSVQE-IBGZPJMESA-N |
| XLogP | 2.37 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|