C30H33ClN4OS — CID 137236719
(6S)-6-[(2R,3R,8aS)-3,8,8-trimethyl-2,3,4,6,7,8a-hexahydro-1H-naphthalen-2-yl]-3-[(2-chlorophenyl)methylsulfanyl]-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one (PubChem CID 137236719) has the molecular formula C30H33ClN4OS and a molecular weight of 533.14 g/mol. Its IUPAC name is (6S)-6-[(2R,3R,8aS)-3,8,8-trimethyl-2,3,4,6,7,8a-hexahydro-1H-naphthalen-2-yl]-3-[(2-chlorophenyl)methylsulfanyl]-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one.
| Compound Name | (6S)-6-[(2R,3R,8aS)-3,8,8-trimethyl-2,3,4,6,7,8a-hexahydro-1H-naphthalen-2-yl]-3-[(2-chlorophenyl)methylsulfanyl]-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
|---|---|
| PubChem CID | 137236719 |
| Molecular Formula | C30H33ClN4OS |
| Molecular Weight | 533.14 g/mol |
| Exact Mass | 532.21 |
| IUPAC Name | (6S)-6-[(2R,3R,8aS)-3,8,8-trimethyl-2,3,4,6,7,8a-hexahydro-1H-naphthalen-2-yl]-3-[(2-chlorophenyl)methylsulfanyl]-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
| SMILES | C[C@@H]1CC2=CCCC(C)(C)[C@@H]2C[C@H]1[C@H]1N=c2ccccc2=C2C(=O)NC(SCc3ccccc3Cl)=NN21 |
| InChI | InChI=1S/C30H33ClN4OS/c1-18-15-19-10-8-14-30(2,3)23(19)16-22(18)27-32-25-13-7-5-11-21(25)26-28(36)33-29(34-35(26)27)37-17-20-9-4-6-12-24(20)31/h4-7,9-13,18,22-23,27H,8,14-17H2,1-3H3,(H,33,34,36)/t18-,22-,23-,27+/m1/s1 |
| InChIKey | XALUHAMWNFIYRG-LZHNYHGMSA-N |
| XLogP | 5.45 |
| TPSA | 57.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.14 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|