C21H19BrN4OS — CID 137236782
(6R)-10-bromo-6-(4-ethylphenyl)-3-prop-2-enylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one (PubChem CID 137236782) has the molecular formula C21H19BrN4OS and a molecular weight of 455.38 g/mol. Its IUPAC name is (6R)-10-bromo-6-(4-ethylphenyl)-3-prop-2-enylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one.
| Compound Name | (6R)-10-bromo-6-(4-ethylphenyl)-3-prop-2-enylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
|---|---|
| PubChem CID | 137236782 |
| Molecular Formula | C21H19BrN4OS |
| Molecular Weight | 455.38 g/mol |
| Exact Mass | 454.05 |
| IUPAC Name | (6R)-10-bromo-6-(4-ethylphenyl)-3-prop-2-enylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
| SMILES | C=CCSC1=NN2C(=c3cc(Br)ccc3=N[C@H]2c2ccc(CC)cc2)C(=O)N1 |
| InChI | InChI=1S/C21H19BrN4OS/c1-3-11-28-21-24-20(27)18-16-12-15(22)9-10-17(16)23-19(26(18)25-21)14-7-5-13(4-2)6-8-14/h3,5-10,12,19H,1,4,11H2,2H3,(H,24,25,27)/t19-/m1/s1 |
| InChIKey | FHXLBRUEXQFOKX-LJQANCHMSA-N |
| XLogP | 3.07 |
| TPSA | 57.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.38 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|