C18H23BrN4OS — CID 137236894
(6R)-10-bromo-6-ethyl-3-hexylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one (PubChem CID 137236894) has the molecular formula C18H23BrN4OS and a molecular weight of 423.38 g/mol. Its IUPAC name is (6R)-10-bromo-6-ethyl-3-hexylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one.
| Compound Name | (6R)-10-bromo-6-ethyl-3-hexylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
|---|---|
| PubChem CID | 137236894 |
| Molecular Formula | C18H23BrN4OS |
| Molecular Weight | 423.38 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | (6R)-10-bromo-6-ethyl-3-hexylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
| SMILES | CCCCCCSC1=NN2C(=c3cc(Br)ccc3=N[C@H]2CC)C(=O)N1 |
| InChI | InChI=1S/C18H23BrN4OS/c1-3-5-6-7-10-25-18-21-17(24)16-13-11-12(19)8-9-14(13)20-15(4-2)23(16)22-18/h8-9,11,15H,3-7,10H2,1-2H3,(H,21,22,24)/t15-/m1/s1 |
| InChIKey | YYIIGFVREACMKC-OAHLLOKOSA-N |
| XLogP | 2.94 |
| TPSA | 57.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.38 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|