C19H21BrN4OS — CID 137237374
(6S)-10-bromo-6-[(1R,6R)-4,6-dimethylcyclohex-3-en-1-yl]-3-methylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one (PubChem CID 137237374) has the molecular formula C19H21BrN4OS and a molecular weight of 433.38 g/mol. Its IUPAC name is (6S)-10-bromo-6-[(1R,6R)-4,6-dimethylcyclohex-3-en-1-yl]-3-methylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one.
| Compound Name | (6S)-10-bromo-6-[(1R,6R)-4,6-dimethylcyclohex-3-en-1-yl]-3-methylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
|---|---|
| PubChem CID | 137237374 |
| Molecular Formula | C19H21BrN4OS |
| Molecular Weight | 433.38 g/mol |
| Exact Mass | 432.06 |
| IUPAC Name | (6S)-10-bromo-6-[(1R,6R)-4,6-dimethylcyclohex-3-en-1-yl]-3-methylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
| SMILES | CSC1=NN2C(=c3cc(Br)ccc3=N[C@@H]2[C@@H]2CC=C(C)C[C@H]2C)C(=O)N1 |
| InChI | InChI=1S/C19H21BrN4OS/c1-10-4-6-13(11(2)8-10)17-21-15-7-5-12(20)9-14(15)16-18(25)22-19(26-3)23-24(16)17/h4-5,7,9,11,13,17H,6,8H2,1-3H3,(H,22,23,25)/t11-,13-,17+/m1/s1 |
| InChIKey | MWIPOPXBTHMSRH-NDGTYSDOSA-N |
| XLogP | 2.57 |
| TPSA | 57.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.38 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|