C20H19BrN4O4S — CID 137237536
(6S)-10-bromo-3-methylsulfanyl-6-(2,3,4-trimethoxyphenyl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one (PubChem CID 137237536) has the molecular formula C20H19BrN4O4S and a molecular weight of 491.37 g/mol. Its IUPAC name is (6S)-10-bromo-3-methylsulfanyl-6-(2,3,4-trimethoxyphenyl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one.
| Compound Name | (6S)-10-bromo-3-methylsulfanyl-6-(2,3,4-trimethoxyphenyl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
|---|---|
| PubChem CID | 137237536 |
| Molecular Formula | C20H19BrN4O4S |
| Molecular Weight | 491.37 g/mol |
| Exact Mass | 490.03 |
| IUPAC Name | (6S)-10-bromo-3-methylsulfanyl-6-(2,3,4-trimethoxyphenyl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
| SMILES | COc1ccc([C@H]2N=c3ccc(Br)cc3=C3C(=O)NC(SC)=NN32)c(OC)c1OC |
| InChI | InChI=1S/C20H19BrN4O4S/c1-27-14-8-6-11(16(28-2)17(14)29-3)18-22-13-7-5-10(21)9-12(13)15-19(26)23-20(30-4)24-25(15)18/h5-9,18H,1-4H3,(H,23,24,26)/t18-/m0/s1 |
| InChIKey | BWBAOOJPCDMBAD-SFHVURJKSA-N |
| XLogP | 1.98 |
| TPSA | 84.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.37 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |