C21H19N5O5S — CID 137237847
(6S)-3-butylsulfanyl-6-(6-nitro-1,3-benzodioxol-5-yl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one (PubChem CID 137237847) has the molecular formula C21H19N5O5S and a molecular weight of 453.48 g/mol. Its IUPAC name is (6S)-3-butylsulfanyl-6-(6-nitro-1,3-benzodioxol-5-yl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one.
| Compound Name | (6S)-3-butylsulfanyl-6-(6-nitro-1,3-benzodioxol-5-yl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
|---|---|
| PubChem CID | 137237847 |
| Molecular Formula | C21H19N5O5S |
| Molecular Weight | 453.48 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | (6S)-3-butylsulfanyl-6-(6-nitro-1,3-benzodioxol-5-yl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
| SMILES | CCCCSC1=NN2C(=c3ccccc3=N[C@@H]2c2cc3c(cc2[N+](=O)[O-])OCO3)C(=O)N1 |
| InChI | InChI=1S/C21H19N5O5S/c1-2-3-8-32-21-23-20(27)18-12-6-4-5-7-14(12)22-19(25(18)24-21)13-9-16-17(31-11-30-16)10-15(13)26(28)29/h4-7,9-10,19H,2-3,8,11H2,1H3,(H,23,24,27)/t19-/m0/s1 |
| InChIKey | TUVXEJMTSPLVSG-IBGZPJMESA-N |
| XLogP | 2.00 |
| TPSA | 118.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.48 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|