C20H18Cl2N4OS — CID 137237912
(6S)-3-butylsulfanyl-6-(2,3-dichlorophenyl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one (PubChem CID 137237912) has the molecular formula C20H18Cl2N4OS and a molecular weight of 433.36 g/mol. Its IUPAC name is (6S)-3-butylsulfanyl-6-(2,3-dichlorophenyl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one.
| Compound Name | (6S)-3-butylsulfanyl-6-(2,3-dichlorophenyl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
|---|---|
| PubChem CID | 137237912 |
| Molecular Formula | C20H18Cl2N4OS |
| Molecular Weight | 433.36 g/mol |
| Exact Mass | 432.06 |
| IUPAC Name | (6S)-3-butylsulfanyl-6-(2,3-dichlorophenyl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
| SMILES | CCCCSC1=NN2C(=c3ccccc3=N[C@@H]2c2cccc(Cl)c2Cl)C(=O)N1 |
| InChI | InChI=1S/C20H18Cl2N4OS/c1-2-3-11-28-20-24-19(27)17-12-7-4-5-10-15(12)23-18(26(17)25-20)13-8-6-9-14(21)16(13)22/h4-10,18H,2-3,11H2,1H3,(H,24,25,27)/t18-/m0/s1 |
| InChIKey | YITBLVRDVAEKTK-SFHVURJKSA-N |
| XLogP | 3.67 |
| TPSA | 57.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.36 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|