About N-[(5-oxo-4H-1,2,4-oxadiazol-3-yl)methyl]prop-2-ynamide
N-[(5-oxo-4H-1,2,4-oxadiazol-3-yl)methyl]prop-2-ynamide (PubChem CID 137238639) has the molecular formula C6H5N3O3
and a molecular weight of 167.12 g/mol. Its IUPAC name is N-[(5-oxo-4H-1,2,4-oxadiazol-3-yl)methyl]prop-2-ynamide.
Molecular Properties
| Compound Name | N-[(5-oxo-4H-1,2,4-oxadiazol-3-yl)methyl]prop-2-ynamide |
| PubChem CID | 137238639 |
| Molecular Formula | C6H5N3O3 |
| Molecular Weight | 167.12 g/mol |
| Exact Mass | 167.03 |
| IUPAC Name | N-[(5-oxo-4H-1,2,4-oxadiazol-3-yl)methyl]prop-2-ynamide |
| SMILES | C#CC(=O)NCc1noc(=O)[nH]1 |
| InChI | InChI=1S/C6H5N3O3/c1-2-5(10)7-3-4-8-6(11)12-9-4/h1H,3H2,(H,7,10)(H,8,9,11) |
| InChIKey | DIROTIXLBGFFEQ-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.12 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(5-oxo-4H-1,2,4-oxadiazol-3-yl)methyl]prop-2-ynamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5-oxo-4H-1,2,4-oxadiazol-3-yl)methyl]prop-2-ynamide?
The IUPAC name of N-[(5-oxo-4H-1,2,4-oxadiazol-3-yl)methyl]prop-2-ynamide (CID 137238639) is N-[(5-oxo-4H-1,2,4-oxadiazol-3-yl)methyl]prop-2-ynamide.
What is the SMILES notation for N-[(5-oxo-4H-1,2,4-oxadiazol-3-yl)methyl]prop-2-ynamide?
The canonical SMILES for N-[(5-oxo-4H-1,2,4-oxadiazol-3-yl)methyl]prop-2-ynamide is C#CC(=O)NCc1noc(=O)[nH]1.
What is the InChIKey of N-[(5-oxo-4H-1,2,4-oxadiazol-3-yl)methyl]prop-2-ynamide?
The InChIKey is DIROTIXLBGFFEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3O3/c1-2-5(10)7-3-4-8-6(11)12-9-4/h1H,3H2,(H,7,10)(H,8,9,11).
What are the key properties of N-[(5-oxo-4H-1,2,4-oxadiazol-3-yl)methyl]prop-2-ynamide?
N-[(5-oxo-4H-1,2,4-oxadiazol-3-yl)methyl]prop-2-ynamide has a molecular weight of 167.12 g/mol, XLogP of -1.39, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5-oxo-4H-1,2,4-oxadiazol-3-yl)methyl]prop-2-ynamide is sourced from PubChem (CID 137238639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).