About N-[(5-oxo-4H-1,2,4-oxadiazol-3-yl)methyl]azetidine-3-carboxamide
N-[(5-oxo-4H-1,2,4-oxadiazol-3-yl)methyl]azetidine-3-carboxamide (PubChem CID 137238706) has the molecular formula C7H10N4O3
and a molecular weight of 198.18 g/mol. Its IUPAC name is N-[(5-oxo-4H-1,2,4-oxadiazol-3-yl)methyl]azetidine-3-carboxamide.
Molecular Properties
| Compound Name | N-[(5-oxo-4H-1,2,4-oxadiazol-3-yl)methyl]azetidine-3-carboxamide |
| PubChem CID | 137238706 |
| Molecular Formula | C7H10N4O3 |
| Molecular Weight | 198.18 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | N-[(5-oxo-4H-1,2,4-oxadiazol-3-yl)methyl]azetidine-3-carboxamide |
| SMILES | O=C(NCc1noc(=O)[nH]1)C1CNC1 |
| InChI | InChI=1S/C7H10N4O3/c12-6(4-1-8-2-4)9-3-5-10-7(13)14-11-5/h4,8H,1-3H2,(H,9,12)(H,10,11,13) |
| InChIKey | QDFYJSSUPUSLFI-UHFFFAOYSA-N |
| XLogP | -1.80 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.18 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(5-oxo-4H-1,2,4-oxadiazol-3-yl)methyl]azetidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5-oxo-4H-1,2,4-oxadiazol-3-yl)methyl]azetidine-3-carboxamide?
The IUPAC name of N-[(5-oxo-4H-1,2,4-oxadiazol-3-yl)methyl]azetidine-3-carboxamide (CID 137238706) is N-[(5-oxo-4H-1,2,4-oxadiazol-3-yl)methyl]azetidine-3-carboxamide.
What is the SMILES notation for N-[(5-oxo-4H-1,2,4-oxadiazol-3-yl)methyl]azetidine-3-carboxamide?
The canonical SMILES for N-[(5-oxo-4H-1,2,4-oxadiazol-3-yl)methyl]azetidine-3-carboxamide is O=C(NCc1noc(=O)[nH]1)C1CNC1.
What is the InChIKey of N-[(5-oxo-4H-1,2,4-oxadiazol-3-yl)methyl]azetidine-3-carboxamide?
The InChIKey is QDFYJSSUPUSLFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N4O3/c12-6(4-1-8-2-4)9-3-5-10-7(13)14-11-5/h4,8H,1-3H2,(H,9,12)(H,10,11,13).
What are the key properties of N-[(5-oxo-4H-1,2,4-oxadiazol-3-yl)methyl]azetidine-3-carboxamide?
N-[(5-oxo-4H-1,2,4-oxadiazol-3-yl)methyl]azetidine-3-carboxamide has a molecular weight of 198.18 g/mol, XLogP of -1.80, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5-oxo-4H-1,2,4-oxadiazol-3-yl)methyl]azetidine-3-carboxamide is sourced from PubChem (CID 137238706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).