C21H23N5O3 — CID 137239962
N-hydroxy-N'-(4-methoxyphenyl)-5-(piperidine-1-carbonyl)-1H-indazole-3-carboximidamide (PubChem CID 137239962) has the molecular formula C21H23N5O3 and a molecular weight of 393.45 g/mol. Its IUPAC name is N-hydroxy-N'-(4-methoxyphenyl)-5-(piperidine-1-carbonyl)-1H-indazole-3-carboximidamide.
| Compound Name | N-hydroxy-N'-(4-methoxyphenyl)-5-(piperidine-1-carbonyl)-1H-indazole-3-carboximidamide |
|---|---|
| PubChem CID | 137239962 |
| Molecular Formula | C21H23N5O3 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | N-hydroxy-N'-(4-methoxyphenyl)-5-(piperidine-1-carbonyl)-1H-indazole-3-carboximidamide |
| SMILES | COc1ccc(/N=C(\NO)c2n[nH]c3ccc(C(=O)N4CCCCC4)cc23)cc1 |
| InChI | InChI=1S/C21H23N5O3/c1-29-16-8-6-15(7-9-16)22-20(25-28)19-17-13-14(5-10-18(17)23-24-19)21(27)26-11-3-2-4-12-26/h5-10,13,28H,2-4,11-12H2,1H3,(H,22,25)(H,23,24) |
| InChIKey | YBTHNVCIDKZBCM-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 102.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|