About 2-ethenyl-4H-1,2,4-triazol-3-one
2-ethenyl-4H-1,2,4-triazol-3-one (PubChem CID 137240478) has the molecular formula C4H5N3O
and a molecular weight of 111.10 g/mol. Its IUPAC name is 2-ethenyl-4H-1,2,4-triazol-3-one.
Molecular Properties
| Compound Name | 2-ethenyl-4H-1,2,4-triazol-3-one |
| PubChem CID | 137240478 |
| Molecular Formula | C4H5N3O |
| Molecular Weight | 111.10 g/mol |
| Exact Mass | 111.04 |
| IUPAC Name | 2-ethenyl-4H-1,2,4-triazol-3-one |
| SMILES | C=Cn1nc[nH]c1=O |
| InChI | InChI=1S/C4H5N3O/c1-2-7-4(8)5-3-6-7/h2-3H,1H2,(H,5,6,8) |
| InChIKey | OOAZNKVUKBKEMX-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.10 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethenyl-4H-1,2,4-triazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenyl-4H-1,2,4-triazol-3-one?
The IUPAC name of 2-ethenyl-4H-1,2,4-triazol-3-one (CID 137240478) is 2-ethenyl-4H-1,2,4-triazol-3-one.
What is the SMILES notation for 2-ethenyl-4H-1,2,4-triazol-3-one?
The canonical SMILES for 2-ethenyl-4H-1,2,4-triazol-3-one is C=Cn1nc[nH]c1=O.
What is the InChIKey of 2-ethenyl-4H-1,2,4-triazol-3-one?
The InChIKey is OOAZNKVUKBKEMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5N3O/c1-2-7-4(8)5-3-6-7/h2-3H,1H2,(H,5,6,8).
What are the key properties of 2-ethenyl-4H-1,2,4-triazol-3-one?
2-ethenyl-4H-1,2,4-triazol-3-one has a molecular weight of 111.10 g/mol, XLogP of -0.33, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenyl-4H-1,2,4-triazol-3-one is sourced from PubChem (CID 137240478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).