C13H14N4O3 — CID 137240810
3-[3-[(3R)-3-(methylideneamino)oxypyrrolidin-1-yl]phenyl]-4H-1,2,4-oxadiazol-5-one (PubChem CID 137240810) has the molecular formula C13H14N4O3 and a molecular weight of 274.28 g/mol. Its IUPAC name is 3-[3-[(3R)-3-(methylideneamino)oxypyrrolidin-1-yl]phenyl]-4H-1,2,4-oxadiazol-5-one.
| Compound Name | 3-[3-[(3R)-3-(methylideneamino)oxypyrrolidin-1-yl]phenyl]-4H-1,2,4-oxadiazol-5-one |
|---|---|
| PubChem CID | 137240810 |
| Molecular Formula | C13H14N4O3 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 3-[3-[(3R)-3-(methylideneamino)oxypyrrolidin-1-yl]phenyl]-4H-1,2,4-oxadiazol-5-one |
| SMILES | C=NO[C@@H]1CCN(c2cccc(-c3noc(=O)[nH]3)c2)C1 |
| InChI | InChI=1S/C13H14N4O3/c1-14-19-11-5-6-17(8-11)10-4-2-3-9(7-10)12-15-13(18)20-16-12/h2-4,7,11H,1,5-6,8H2,(H,15,16,18)/t11-/m1/s1 |
| InChIKey | YUDBHZPUKRDZCC-LLVKDONJSA-N |
| XLogP | 1.24 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|