C17H16N2O5S — CID 137241592
4-[[4-(furan-2-yl)-2-hydroxy-6-oxocyclohexen-1-yl]methylideneamino]benzenesulfonamide (PubChem CID 137241592) has the molecular formula C17H16N2O5S and a molecular weight of 360.39 g/mol. Its IUPAC name is 4-[[4-(furan-2-yl)-2-hydroxy-6-oxocyclohexen-1-yl]methylideneamino]benzenesulfonamide.
| Compound Name | 4-[[4-(furan-2-yl)-2-hydroxy-6-oxocyclohexen-1-yl]methylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 137241592 |
| Molecular Formula | C17H16N2O5S |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 4-[[4-(furan-2-yl)-2-hydroxy-6-oxocyclohexen-1-yl]methylideneamino]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(/N=C/C2=C(O)CC(c3ccco3)CC2=O)cc1 |
| InChI | InChI=1S/C17H16N2O5S/c18-25(22,23)13-5-3-12(4-6-13)19-10-14-15(20)8-11(9-16(14)21)17-2-1-7-24-17/h1-7,10-11,20H,8-9H2,(H2,18,22,23)/b19-10+ |
| InChIKey | CDROLXSKNOBOBV-VXLYETTFSA-N |
| XLogP | 2.59 |
| TPSA | 122.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|