C10H11ClN6O4S — CID 137241828
1-[(3S,4S)-4-chloro-1,1-dioxothiolan-3-yl]-3-(6-oxo-1,7-dihydropurin-2-yl)urea (PubChem CID 137241828) has the molecular formula C10H11ClN6O4S and a molecular weight of 346.76 g/mol. Its IUPAC name is 1-[(3S,4S)-4-chloro-1,1-dioxothiolan-3-yl]-3-(6-oxo-1,7-dihydropurin-2-yl)urea.
| Compound Name | 1-[(3S,4S)-4-chloro-1,1-dioxothiolan-3-yl]-3-(6-oxo-1,7-dihydropurin-2-yl)urea |
|---|---|
| PubChem CID | 137241828 |
| Molecular Formula | C10H11ClN6O4S |
| Molecular Weight | 346.76 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | 1-[(3S,4S)-4-chloro-1,1-dioxothiolan-3-yl]-3-(6-oxo-1,7-dihydropurin-2-yl)urea |
| SMILES | O=C(Nc1nc2nc[nH]c2c(=O)[nH]1)N[C@H]1CS(=O)(=O)C[C@H]1Cl |
| InChI | InChI=1S/C10H11ClN6O4S/c11-4-1-22(20,21)2-5(4)14-10(19)17-9-15-7-6(8(18)16-9)12-3-13-7/h3-5H,1-2H2,(H4,12,13,14,15,16,17,18,19)/t4-,5+/m1/s1 |
| InChIKey | XOGYPATVAWFHNA-UHNVWZDZSA-N |
| XLogP | -0.83 |
| TPSA | 149.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.76 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|