C6H9N3OS — CID 137242902
3-cyclobutylsulfanyl-1,4-dihydro-1,2,4-triazol-5-one (PubChem CID 137242902) has the molecular formula C6H9N3OS and a molecular weight of 171.22 g/mol. Its IUPAC name is 3-cyclobutylsulfanyl-1,4-dihydro-1,2,4-triazol-5-one.
| Compound Name | 3-cyclobutylsulfanyl-1,4-dihydro-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 137242902 |
| Molecular Formula | C6H9N3OS |
| Molecular Weight | 171.22 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | 3-cyclobutylsulfanyl-1,4-dihydro-1,2,4-triazol-5-one |
| SMILES | O=c1[nH]nc(SC2CCC2)[nH]1 |
| InChI | InChI=1S/C6H9N3OS/c10-5-7-6(9-8-5)11-4-2-1-3-4/h4H,1-3H2,(H2,7,8,9,10) |
| InChIKey | CHQMTQCFVCCXBM-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 61.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.22 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |