About 4-methyl-N-(2-methylthiolan-3-yl)-1,3-thiazinan-2-imine
4-methyl-N-(2-methylthiolan-3-yl)-1,3-thiazinan-2-imine (PubChem CID 137243262) has the molecular formula C10H18N2S2
and a molecular weight of 230.40 g/mol. Its IUPAC name is 4-methyl-N-(2-methylthiolan-3-yl)-1,3-thiazinan-2-imine.
Molecular Properties
| Compound Name | 4-methyl-N-(2-methylthiolan-3-yl)-1,3-thiazinan-2-imine |
| PubChem CID | 137243262 |
| Molecular Formula | C10H18N2S2 |
| Molecular Weight | 230.40 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 4-methyl-N-(2-methylthiolan-3-yl)-1,3-thiazinan-2-imine |
| SMILES | CC1CCS/C(=N\C2CCSC2C)N1 |
| InChI | InChI=1S/C10H18N2S2/c1-7-3-5-14-10(11-7)12-9-4-6-13-8(9)2/h7-9H,3-6H2,1-2H3,(H,11,12) |
| InChIKey | CHVPIZPBXZEQLM-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.40 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-N-(2-methylthiolan-3-yl)-1,3-thiazinan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-N-(2-methylthiolan-3-yl)-1,3-thiazinan-2-imine?
The IUPAC name of 4-methyl-N-(2-methylthiolan-3-yl)-1,3-thiazinan-2-imine (CID 137243262) is 4-methyl-N-(2-methylthiolan-3-yl)-1,3-thiazinan-2-imine.
What is the SMILES notation for 4-methyl-N-(2-methylthiolan-3-yl)-1,3-thiazinan-2-imine?
The canonical SMILES for 4-methyl-N-(2-methylthiolan-3-yl)-1,3-thiazinan-2-imine is CC1CCS/C(=N\C2CCSC2C)N1.
What is the InChIKey of 4-methyl-N-(2-methylthiolan-3-yl)-1,3-thiazinan-2-imine?
The InChIKey is CHVPIZPBXZEQLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2S2/c1-7-3-5-14-10(11-7)12-9-4-6-13-8(9)2/h7-9H,3-6H2,1-2H3,(H,11,12).
What are the key properties of 4-methyl-N-(2-methylthiolan-3-yl)-1,3-thiazinan-2-imine?
4-methyl-N-(2-methylthiolan-3-yl)-1,3-thiazinan-2-imine has a molecular weight of 230.40 g/mol, XLogP of 2.35, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-N-(2-methylthiolan-3-yl)-1,3-thiazinan-2-imine is sourced from PubChem (CID 137243262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).