About 4-(4H-3,1-benzothiazin-2-yl)benzene-1,3-diol
4-(4H-3,1-benzothiazin-2-yl)benzene-1,3-diol (PubChem CID 137243374) has the molecular formula C14H11NO2S
and a molecular weight of 257.31 g/mol. Its IUPAC name is 4-(4H-3,1-benzothiazin-2-yl)benzene-1,3-diol.
Molecular Properties
| Compound Name | 4-(4H-3,1-benzothiazin-2-yl)benzene-1,3-diol |
| PubChem CID | 137243374 |
| Molecular Formula | C14H11NO2S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | 4-(4H-3,1-benzothiazin-2-yl)benzene-1,3-diol |
| SMILES | Oc1ccc(C2=Nc3ccccc3CS2)c(O)c1 |
| InChI | InChI=1S/C14H11NO2S/c16-10-5-6-11(13(17)7-10)14-15-12-4-2-1-3-9(12)8-18-14/h1-7,16-17H,8H2 |
| InChIKey | HROQTXGBXYLDNK-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(4H-3,1-benzothiazin-2-yl)benzene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4H-3,1-benzothiazin-2-yl)benzene-1,3-diol?
The IUPAC name of 4-(4H-3,1-benzothiazin-2-yl)benzene-1,3-diol (CID 137243374) is 4-(4H-3,1-benzothiazin-2-yl)benzene-1,3-diol.
What is the SMILES notation for 4-(4H-3,1-benzothiazin-2-yl)benzene-1,3-diol?
The canonical SMILES for 4-(4H-3,1-benzothiazin-2-yl)benzene-1,3-diol is Oc1ccc(C2=Nc3ccccc3CS2)c(O)c1.
What is the InChIKey of 4-(4H-3,1-benzothiazin-2-yl)benzene-1,3-diol?
The InChIKey is HROQTXGBXYLDNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11NO2S/c16-10-5-6-11(13(17)7-10)14-15-12-4-2-1-3-9(12)8-18-14/h1-7,16-17H,8H2.
What are the key properties of 4-(4H-3,1-benzothiazin-2-yl)benzene-1,3-diol?
4-(4H-3,1-benzothiazin-2-yl)benzene-1,3-diol has a molecular weight of 257.31 g/mol, XLogP of 3.42, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4H-3,1-benzothiazin-2-yl)benzene-1,3-diol is sourced from PubChem (CID 137243374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).