C11H11BrFN5O2 — CID 137245067
N'-(3-bromo-4-fluorophenyl)-4-(ethylamino)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 137245067) has the molecular formula C11H11BrFN5O2 and a molecular weight of 344.14 g/mol. Its IUPAC name is N'-(3-bromo-4-fluorophenyl)-4-(ethylamino)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-bromo-4-fluorophenyl)-4-(ethylamino)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 137245067 |
| Molecular Formula | C11H11BrFN5O2 |
| Molecular Weight | 344.14 g/mol |
| Exact Mass | 343.01 |
| IUPAC Name | N'-(3-bromo-4-fluorophenyl)-4-(ethylamino)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | CCNc1nonc1/C(=N/c1ccc(F)c(Br)c1)NO |
| InChI | InChI=1S/C11H11BrFN5O2/c1-2-14-10-9(17-20-18-10)11(16-19)15-6-3-4-8(13)7(12)5-6/h3-5,19H,2H2,1H3,(H,14,18)(H,15,16) |
| InChIKey | KUNZKTGDJQRVGH-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 95.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.14 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|