C23H31ClN4O2 — CID 137246196
(NE)-N-[(4aS)-7-[(2Z,4E)-5-chlorohepta-2,4-dien-4-yl]-2-(2-cyclohexa-2,4-dien-1-yloxyethylimino)-1,4a,6,7,8,8a-hexahydroquinazolin-5-ylidene]hydroxylamine (PubChem CID 137246196) has the molecular formula C23H31ClN4O2 and a molecular weight of 430.98 g/mol. Its IUPAC name is (NE)-N-[(4aS)-7-[(2Z,4E)-5-chlorohepta-2,4-dien-4-yl]-2-(2-cyclohexa-2,4-dien-1-yloxyethylimino)-1,4a,6,7,8,8a-hexahydroquinazolin-5-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[(4aS)-7-[(2Z,4E)-5-chlorohepta-2,4-dien-4-yl]-2-(2-cyclohexa-2,4-dien-1-yloxyethylimino)-1,4a,6,7,8,8a-hexahydroquinazolin-5-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 137246196 |
| Molecular Formula | C23H31ClN4O2 |
| Molecular Weight | 430.98 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | (NE)-N-[(4aS)-7-[(2Z,4E)-5-chlorohepta-2,4-dien-4-yl]-2-(2-cyclohexa-2,4-dien-1-yloxyethylimino)-1,4a,6,7,8,8a-hexahydroquinazolin-5-ylidene]hydroxylamine |
| SMILES | C/C=C\C(=C(\Cl)CC)C1C/C(=N\O)[C@@H]2C=N/C(=N\CCOC3C=CC=CC3)NC2C1 |
| InChI | InChI=1S/C23H31ClN4O2/c1-3-8-18(20(24)4-2)16-13-21-19(22(14-16)28-29)15-26-23(27-21)25-11-12-30-17-9-6-5-7-10-17/h3,5-9,15-17,19,21,29H,4,10-14H2,1-2H3,(H,25,27)/b8-3-,20-18-,28-22+/t16?,17?,19-,21?/m1/s1 |
| InChIKey | HZDBVHKYNFPHLQ-AQFCWLAISA-N |
| XLogP | 4.62 |
| TPSA | 78.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.98 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|