C14H15FN4O — CID 137247072
(Z)-1-[5-(4-fluorophenyl)-1H-pyrazol-4-yl]-N-morpholin-4-ylmethanimine (PubChem CID 137247072) has the molecular formula C14H15FN4O and a molecular weight of 274.30 g/mol. Its IUPAC name is (Z)-1-[5-(4-fluorophenyl)-1H-pyrazol-4-yl]-N-morpholin-4-ylmethanimine.
| Compound Name | (Z)-1-[5-(4-fluorophenyl)-1H-pyrazol-4-yl]-N-morpholin-4-ylmethanimine |
|---|---|
| PubChem CID | 137247072 |
| Molecular Formula | C14H15FN4O |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | (Z)-1-[5-(4-fluorophenyl)-1H-pyrazol-4-yl]-N-morpholin-4-ylmethanimine |
| SMILES | Fc1ccc(-c2[nH]ncc2/C=N\N2CCOCC2)cc1 |
| InChI | InChI=1S/C14H15FN4O/c15-13-3-1-11(2-4-13)14-12(9-16-18-14)10-17-19-5-7-20-8-6-19/h1-4,9-10H,5-8H2,(H,16,18)/b17-10- |
| InChIKey | MTFSCSITKSQKBJ-YVLHZVERSA-N |
| XLogP | 1.88 |
| TPSA | 53.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|