About 3-[(cycloheptylamino)methyl]-2-methoxy-6-(2-pyridin-2-ylethyl)pyrrolo[3,4-b]pyridin-5-ol
3-[(cycloheptylamino)methyl]-2-methoxy-6-(2-pyridin-2-ylethyl)pyrrolo[3,4-b]pyridin-5-ol (PubChem CID 137247128) has the molecular formula C23H30N4O2
and a molecular weight of 394.52 g/mol. Its IUPAC name is 3-[(cycloheptylamino)methyl]-2-methoxy-6-(2-pyridin-2-ylethyl)pyrrolo[3,4-b]pyridin-5-ol.
Molecular Properties
| Compound Name | 3-[(cycloheptylamino)methyl]-2-methoxy-6-(2-pyridin-2-ylethyl)pyrrolo[3,4-b]pyridin-5-ol |
| PubChem CID | 137247128 |
| Molecular Formula | C23H30N4O2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | 3-[(cycloheptylamino)methyl]-2-methoxy-6-(2-pyridin-2-ylethyl)pyrrolo[3,4-b]pyridin-5-ol |
| SMILES | COc1nc2cn(CCc3ccccn3)c(O)c2cc1CNC1CCCCCC1 |
| InChI | InChI=1S/C23H30N4O2/c1-29-22-17(15-25-18-8-4-2-3-5-9-18)14-20-21(26-22)16-27(23(20)28)13-11-19-10-6-7-12-24-19/h6-7,10,12,14,16,18,25,28H,2-5,8-9,11,13,15H2,1H3 |
| InChIKey | HTJKBYMCPCRCID-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[(cycloheptylamino)methyl]-2-methoxy-6-(2-pyridin-2-ylethyl)pyrrolo[3,4-b]pyridin-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(cycloheptylamino)methyl]-2-methoxy-6-(2-pyridin-2-ylethyl)pyrrolo[3,4-b]pyridin-5-ol?
The IUPAC name of 3-[(cycloheptylamino)methyl]-2-methoxy-6-(2-pyridin-2-ylethyl)pyrrolo[3,4-b]pyridin-5-ol (CID 137247128) is 3-[(cycloheptylamino)methyl]-2-methoxy-6-(2-pyridin-2-ylethyl)pyrrolo[3,4-b]pyridin-5-ol.
What is the SMILES notation for 3-[(cycloheptylamino)methyl]-2-methoxy-6-(2-pyridin-2-ylethyl)pyrrolo[3,4-b]pyridin-5-ol?
The canonical SMILES for 3-[(cycloheptylamino)methyl]-2-methoxy-6-(2-pyridin-2-ylethyl)pyrrolo[3,4-b]pyridin-5-ol is COc1nc2cn(CCc3ccccn3)c(O)c2cc1CNC1CCCCCC1.
What is the InChIKey of 3-[(cycloheptylamino)methyl]-2-methoxy-6-(2-pyridin-2-ylethyl)pyrrolo[3,4-b]pyridin-5-ol?
The InChIKey is HTJKBYMCPCRCID-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H30N4O2/c1-29-22-17(15-25-18-8-4-2-3-5-9-18)14-20-21(26-22)16-27(23(20)28)13-11-19-10-6-7-12-24-19/h6-7,10,12,14,16,18,25,28H,2-5,8-9,11,13,15H2,1H3.
What are the key properties of 3-[(cycloheptylamino)methyl]-2-methoxy-6-(2-pyridin-2-ylethyl)pyrrolo[3,4-b]pyridin-5-ol?
3-[(cycloheptylamino)methyl]-2-methoxy-6-(2-pyridin-2-ylethyl)pyrrolo[3,4-b]pyridin-5-ol has a molecular weight of 394.52 g/mol, XLogP of 4.20, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(cycloheptylamino)methyl]-2-methoxy-6-(2-pyridin-2-ylethyl)pyrrolo[3,4-b]pyridin-5-ol is sourced from PubChem (CID 137247128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).