C41H38N4O3S — CID 137247263
2-[4-(1,3-benzothiazol-2-yl)-3-hydroxyphenyl]-3',6'-bis(diethylamino)spiro[isoindole-3,9'-xanthene]-1-one (PubChem CID 137247263) has the molecular formula C41H38N4O3S and a molecular weight of 666.85 g/mol. Its IUPAC name is 2-[4-(1,3-benzothiazol-2-yl)-3-hydroxyphenyl]-3',6'-bis(diethylamino)spiro[isoindole-3,9'-xanthene]-1-one.
| Compound Name | 2-[4-(1,3-benzothiazol-2-yl)-3-hydroxyphenyl]-3',6'-bis(diethylamino)spiro[isoindole-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 137247263 |
| Molecular Formula | C41H38N4O3S |
| Molecular Weight | 666.85 g/mol |
| Exact Mass | 666.27 |
| IUPAC Name | 2-[4-(1,3-benzothiazol-2-yl)-3-hydroxyphenyl]-3',6'-bis(diethylamino)spiro[isoindole-3,9'-xanthene]-1-one |
| SMILES | CCN(CC)c1ccc2c(c1)Oc1cc(N(CC)CC)ccc1C21c2ccccc2C(=O)N1c1ccc(-c2nc3ccccc3s2)c(O)c1 |
| InChI | InChI=1S/C41H38N4O3S/c1-5-43(6-2)26-18-21-32-36(24-26)48-37-25-27(44(7-3)8-4)19-22-33(37)41(32)31-14-10-9-13-29(31)40(47)45(41)28-17-20-30(35(46)23-28)39-42-34-15-11-12-16-38(34)49-39/h9-25,46H,5-8H2,1-4H3 |
| InChIKey | JIMHFSJUACVJCU-UHFFFAOYSA-N |
| XLogP | 9.42 |
| TPSA | 69.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.85 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|