C19H30F2N5P — CID 137247853
(2Z,4Z)-1-[[2-[1-(ethylamino)ethenyl]-1,4-dihydropyridin-3-yl]methylideneamino]-8,8-difluoro-4-methyl-8-phosphanylocta-2,4-diene-2,5-diamine (PubChem CID 137247853) has the molecular formula C19H30F2N5P and a molecular weight of 397.45 g/mol. Its IUPAC name is (2Z,4Z)-1-[[2-[1-(ethylamino)ethenyl]-1,4-dihydropyridin-3-yl]methylideneamino]-8,8-difluoro-4-methyl-8-phosphanylocta-2,4-diene-2,5-diamine.
| Compound Name | (2Z,4Z)-1-[[2-[1-(ethylamino)ethenyl]-1,4-dihydropyridin-3-yl]methylideneamino]-8,8-difluoro-4-methyl-8-phosphanylocta-2,4-diene-2,5-diamine |
|---|---|
| PubChem CID | 137247853 |
| Molecular Formula | C19H30F2N5P |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | (2Z,4Z)-1-[[2-[1-(ethylamino)ethenyl]-1,4-dihydropyridin-3-yl]methylideneamino]-8,8-difluoro-4-methyl-8-phosphanylocta-2,4-diene-2,5-diamine |
| SMILES | C=C(NCC)C1=C(/C=N/C/C(N)=C/C(C)=C(\N)CCC(F)(F)P)CC=CN1 |
| InChI | InChI=1S/C19H30F2N5P/c1-4-25-14(3)18-15(6-5-9-26-18)11-24-12-16(22)10-13(2)17(23)7-8-19(20,21)27/h5,9-11,25-26H,3-4,6-8,12,22-23,27H2,1-2H3/b16-10-,17-13-,24-11+ |
| InChIKey | XEAUKLQLEWFVAK-FCSQMNGVSA-N |
| XLogP | 3.26 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|