About (3E)-3-(aminomethylidene)-6-methyl-2-pentylimino-1,4-dihydropyridin-4-amine
(3E)-3-(aminomethylidene)-6-methyl-2-pentylimino-1,4-dihydropyridin-4-amine (PubChem CID 137247912) has the molecular formula C12H22N4
and a molecular weight of 222.34 g/mol. Its IUPAC name is (3E)-3-(aminomethylidene)-6-methyl-2-pentylimino-1,4-dihydropyridin-4-amine.
Molecular Properties
| Compound Name | (3E)-3-(aminomethylidene)-6-methyl-2-pentylimino-1,4-dihydropyridin-4-amine |
| PubChem CID | 137247912 |
| Molecular Formula | C12H22N4 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | (3E)-3-(aminomethylidene)-6-methyl-2-pentylimino-1,4-dihydropyridin-4-amine |
| SMILES | CCCCC/N=C1\NC(C)=CC(N)\C1=C/N |
| InChI | InChI=1S/C12H22N4/c1-3-4-5-6-15-12-10(8-13)11(14)7-9(2)16-12/h7-8,11H,3-6,13-14H2,1-2H3,(H,15,16)/b10-8+ |
| InChIKey | UVPYVIBICOOYHI-CSKARUKUSA-N |
| XLogP | 1.25 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (3E)-3-(aminomethylidene)-6-methyl-2-pentylimino-1,4-dihydropyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-3-(aminomethylidene)-6-methyl-2-pentylimino-1,4-dihydropyridin-4-amine?
The IUPAC name of (3E)-3-(aminomethylidene)-6-methyl-2-pentylimino-1,4-dihydropyridin-4-amine (CID 137247912) is (3E)-3-(aminomethylidene)-6-methyl-2-pentylimino-1,4-dihydropyridin-4-amine.
What is the SMILES notation for (3E)-3-(aminomethylidene)-6-methyl-2-pentylimino-1,4-dihydropyridin-4-amine?
The canonical SMILES for (3E)-3-(aminomethylidene)-6-methyl-2-pentylimino-1,4-dihydropyridin-4-amine is CCCCC/N=C1\NC(C)=CC(N)\C1=C/N.
What is the InChIKey of (3E)-3-(aminomethylidene)-6-methyl-2-pentylimino-1,4-dihydropyridin-4-amine?
The InChIKey is UVPYVIBICOOYHI-CSKARUKUSA-N. The full InChI is InChI=1S/C12H22N4/c1-3-4-5-6-15-12-10(8-13)11(14)7-9(2)16-12/h7-8,11H,3-6,13-14H2,1-2H3,(H,15,16)/b10-8+.
What are the key properties of (3E)-3-(aminomethylidene)-6-methyl-2-pentylimino-1,4-dihydropyridin-4-amine?
(3E)-3-(aminomethylidene)-6-methyl-2-pentylimino-1,4-dihydropyridin-4-amine has a molecular weight of 222.34 g/mol, XLogP of 1.25, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-3-(aminomethylidene)-6-methyl-2-pentylimino-1,4-dihydropyridin-4-amine is sourced from PubChem (CID 137247912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).