C18H20N6O — CID 137248163
3-[1-[[(3S)-1-prop-2-enylpyrrolidin-3-yl]amino]isoquinolin-3-yl]-1,4-dihydro-1,2,4-triazol-5-one (PubChem CID 137248163) has the molecular formula C18H20N6O and a molecular weight of 336.40 g/mol. Its IUPAC name is 3-[1-[[(3S)-1-prop-2-enylpyrrolidin-3-yl]amino]isoquinolin-3-yl]-1,4-dihydro-1,2,4-triazol-5-one.
| Compound Name | 3-[1-[[(3S)-1-prop-2-enylpyrrolidin-3-yl]amino]isoquinolin-3-yl]-1,4-dihydro-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 137248163 |
| Molecular Formula | C18H20N6O |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 3-[1-[[(3S)-1-prop-2-enylpyrrolidin-3-yl]amino]isoquinolin-3-yl]-1,4-dihydro-1,2,4-triazol-5-one |
| SMILES | C=CCN1CC[C@H](Nc2nc(-c3n[nH]c(=O)[nH]3)cc3ccccc23)C1 |
| InChI | InChI=1S/C18H20N6O/c1-2-8-24-9-7-13(11-24)19-16-14-6-4-3-5-12(14)10-15(20-16)17-21-18(25)23-22-17/h2-6,10,13H,1,7-9,11H2,(H,19,20)(H2,21,22,23,25)/t13-/m0/s1 |
| InChIKey | KDLUAEKQDOWMMW-ZDUSSCGKSA-N |
| XLogP | 1.99 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|