C18H21N3O3S2 — CID 137248450
methyl 2-butylsulfanyl-7-methyl-4-oxo-5-thiophen-2-yl-5,6-dihydro-3H-pyrido[2,3-d]pyrimidine-6-carboxylate (PubChem CID 137248450) has the molecular formula C18H21N3O3S2 and a molecular weight of 391.52 g/mol. Its IUPAC name is methyl 2-butylsulfanyl-7-methyl-4-oxo-5-thiophen-2-yl-5,6-dihydro-3H-pyrido[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | methyl 2-butylsulfanyl-7-methyl-4-oxo-5-thiophen-2-yl-5,6-dihydro-3H-pyrido[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 137248450 |
| Molecular Formula | C18H21N3O3S2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | methyl 2-butylsulfanyl-7-methyl-4-oxo-5-thiophen-2-yl-5,6-dihydro-3H-pyrido[2,3-d]pyrimidine-6-carboxylate |
| SMILES | CCCCSc1nc2c(c(=O)[nH]1)C(c1cccs1)C(C(=O)OC)C(C)=N2 |
| InChI | InChI=1S/C18H21N3O3S2/c1-4-5-8-26-18-20-15-14(16(22)21-18)13(11-7-6-9-25-11)12(10(2)19-15)17(23)24-3/h6-7,9,12-13H,4-5,8H2,1-3H3,(H,20,21,22) |
| InChIKey | NNEUSBVXFPEUSY-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 84.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|