C14H16N2O3S — CID 137249139
(5Z)-2-(3-hydroxypropylimino)-5-[(2-methoxyphenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 137249139) has the molecular formula C14H16N2O3S and a molecular weight of 292.36 g/mol. Its IUPAC name is (5Z)-2-(3-hydroxypropylimino)-5-[(2-methoxyphenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(3-hydroxypropylimino)-5-[(2-methoxyphenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137249139 |
| Molecular Formula | C14H16N2O3S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | (5Z)-2-(3-hydroxypropylimino)-5-[(2-methoxyphenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | COc1ccccc1/C=C1\S/C(=N/CCCO)NC1=O |
| InChI | InChI=1S/C14H16N2O3S/c1-19-11-6-3-2-5-10(11)9-12-13(18)16-14(20-12)15-7-4-8-17/h2-3,5-6,9,17H,4,7-8H2,1H3,(H,15,16,18)/b12-9- |
| InChIKey | KHVIQPNLBRSGKC-XFXZXTDPSA-N |
| XLogP | 1.64 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|