C12H9N5OS2 — CID 137249251
4-hydroxy-3-phenyl-5-[(E)-1H-1,2,4-triazol-5-yliminomethyl]-1,3-thiazole-2-thione (PubChem CID 137249251) has the molecular formula C12H9N5OS2 and a molecular weight of 303.37 g/mol. Its IUPAC name is 4-hydroxy-3-phenyl-5-[(E)-1H-1,2,4-triazol-5-yliminomethyl]-1,3-thiazole-2-thione.
| Compound Name | 4-hydroxy-3-phenyl-5-[(E)-1H-1,2,4-triazol-5-yliminomethyl]-1,3-thiazole-2-thione |
|---|---|
| PubChem CID | 137249251 |
| Molecular Formula | C12H9N5OS2 |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.02 |
| IUPAC Name | 4-hydroxy-3-phenyl-5-[(E)-1H-1,2,4-triazol-5-yliminomethyl]-1,3-thiazole-2-thione |
| SMILES | Oc1c(/C=N/c2ncn[nH]2)sc(=S)n1-c1ccccc1 |
| InChI | InChI=1S/C12H9N5OS2/c18-10-9(6-13-11-14-7-15-16-11)20-12(19)17(10)8-4-2-1-3-5-8/h1-7,18H,(H,14,15,16)/b13-6+ |
| InChIKey | CBWPXDAJFNAXEM-AWNIVKPZSA-N |
| XLogP | 2.84 |
| TPSA | 79.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|