C19H20N2O3 — CID 137249377
(3S)-3-benzyl-7,8-dimethoxy-5-methyl-1,3-dihydro-1,4-benzodiazepin-2-one (PubChem CID 137249377) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is (3S)-3-benzyl-7,8-dimethoxy-5-methyl-1,3-dihydro-1,4-benzodiazepin-2-one.
| Compound Name | (3S)-3-benzyl-7,8-dimethoxy-5-methyl-1,3-dihydro-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 137249377 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | (3S)-3-benzyl-7,8-dimethoxy-5-methyl-1,3-dihydro-1,4-benzodiazepin-2-one |
| SMILES | COc1cc2c(cc1OC)C(C)=N[C@@H](Cc1ccccc1)C(=O)N2 |
| InChI | InChI=1S/C19H20N2O3/c1-12-14-10-17(23-2)18(24-3)11-15(14)21-19(22)16(20-12)9-13-7-5-4-6-8-13/h4-8,10-11,16H,9H2,1-3H3,(H,21,22)/t16-/m0/s1 |
| InChIKey | NDZUCDUZCISSON-INIZCTEOSA-N |
| XLogP | 3.08 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |