C19H15ClN6 — CID 137250210
2-(2-chlorophenyl)-4-methyl-6-phenyl-1,5,6,8,10,12-hexazatricyclo[7.3.0.03,7]dodeca-3(7),4,9,11-tetraene (PubChem CID 137250210) has the molecular formula C19H15ClN6 and a molecular weight of 362.82 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-4-methyl-6-phenyl-1,5,6,8,10,12-hexazatricyclo[7.3.0.03,7]dodeca-3(7),4,9,11-tetraene.
| Compound Name | 2-(2-chlorophenyl)-4-methyl-6-phenyl-1,5,6,8,10,12-hexazatricyclo[7.3.0.03,7]dodeca-3(7),4,9,11-tetraene |
|---|---|
| PubChem CID | 137250210 |
| Molecular Formula | C19H15ClN6 |
| Molecular Weight | 362.82 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 2-(2-chlorophenyl)-4-methyl-6-phenyl-1,5,6,8,10,12-hexazatricyclo[7.3.0.03,7]dodeca-3(7),4,9,11-tetraene |
| SMILES | Cc1nn(-c2ccccc2)c2c1C(c1ccccc1Cl)n1ncnc1N2 |
| InChI | InChI=1S/C19H15ClN6/c1-12-16-17(14-9-5-6-10-15(14)20)26-19(21-11-22-26)23-18(16)25(24-12)13-7-3-2-4-8-13/h2-11,17H,1H3,(H,21,22,23) |
| InChIKey | CFDXLJLYPYZHAU-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 60.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.82 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |