C19H24N4O — CID 137250270
2-hydrazinyl-7,10-dimethylspiro[3,6-dihydrobenzo[h]quinazoline-5,1'-cyclohexane]-4-one (PubChem CID 137250270) has the molecular formula C19H24N4O and a molecular weight of 324.43 g/mol. Its IUPAC name is 2-hydrazinyl-7,10-dimethylspiro[3,6-dihydrobenzo[h]quinazoline-5,1'-cyclohexane]-4-one.
| Compound Name | 2-hydrazinyl-7,10-dimethylspiro[3,6-dihydrobenzo[h]quinazoline-5,1'-cyclohexane]-4-one |
|---|---|
| PubChem CID | 137250270 |
| Molecular Formula | C19H24N4O |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | 2-hydrazinyl-7,10-dimethylspiro[3,6-dihydrobenzo[h]quinazoline-5,1'-cyclohexane]-4-one |
| SMILES | Cc1ccc(C)c2c1CC1(CCCCC1)c1c-2nc(NN)[nH]c1=O |
| InChI | InChI=1S/C19H24N4O/c1-11-6-7-12(2)14-13(11)10-19(8-4-3-5-9-19)15-16(14)21-18(23-20)22-17(15)24/h6-7H,3-5,8-10,20H2,1-2H3,(H2,21,22,23,24) |
| InChIKey | MSGSTFZZHMZRID-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|