C17H25N3O3 — CID 137250376
tert-butyl (1S,9S)-4,10-dimethyl-6-oxo-3,5,13-triazatricyclo[7.3.1.02,7]trideca-2(7),3-diene-13-carboxylate (PubChem CID 137250376) has the molecular formula C17H25N3O3 and a molecular weight of 319.41 g/mol. Its IUPAC name is tert-butyl (1S,9S)-4,10-dimethyl-6-oxo-3,5,13-triazatricyclo[7.3.1.02,7]trideca-2(7),3-diene-13-carboxylate.
| Compound Name | tert-butyl (1S,9S)-4,10-dimethyl-6-oxo-3,5,13-triazatricyclo[7.3.1.02,7]trideca-2(7),3-diene-13-carboxylate |
|---|---|
| PubChem CID | 137250376 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | tert-butyl (1S,9S)-4,10-dimethyl-6-oxo-3,5,13-triazatricyclo[7.3.1.02,7]trideca-2(7),3-diene-13-carboxylate |
| SMILES | Cc1nc2c(c(=O)[nH]1)C[C@H]1C(C)CC[C@@H]2N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H25N3O3/c1-9-6-7-12-14-11(15(21)19-10(2)18-14)8-13(9)20(12)16(22)23-17(3,4)5/h9,12-13H,6-8H2,1-5H3,(H,18,19,21)/t9?,12-,13-/m0/s1 |
| InChIKey | MAOXICZHSVOMEU-AXRFISIWSA-N |
| XLogP | 2.71 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |