C46H37BrN8O2 — CID 137250586
methyl 5-[4-(10,15,20-tripyridin-4-yl-21,23-dihydroporphyrin-5-yl)pyridin-1-ium-1-yl]pentanoate bromide (PubChem CID 137250586) has the molecular formula C46H37BrN8O2 and a molecular weight of 813.76 g/mol. Its IUPAC name is methyl 5-[4-(10,15,20-tripyridin-4-yl-21,23-dihydroporphyrin-5-yl)pyridin-1-ium-1-yl]pentanoate bromide.
| Compound Name | methyl 5-[4-(10,15,20-tripyridin-4-yl-21,23-dihydroporphyrin-5-yl)pyridin-1-ium-1-yl]pentanoate bromide |
|---|---|
| PubChem CID | 137250586 |
| Molecular Formula | C46H37BrN8O2 |
| Molecular Weight | 813.76 g/mol |
| Exact Mass | 812.22 |
| IUPAC Name | methyl 5-[4-(10,15,20-tripyridin-4-yl-21,23-dihydroporphyrin-5-yl)pyridin-1-ium-1-yl]pentanoate bromide |
| SMILES | COC(=O)CCCC[n+]1ccc(-c2c3nc(c(-c4ccncc4)c4ccc([nH]4)c(-c4ccncc4)c4nc(c(-c5ccncc5)c5ccc2[nH]5)C=C4)C=C3)cc1.[Br-] |
| InChI | InChI=1S/C46H36N8O2.BrH/c1-56-42(55)4-2-3-27-54-28-19-33(20-29-54)46-40-11-9-38(52-40)44(31-15-23-48-24-16-31)36-7-5-34(50-36)43(30-13-21-47-22-14-30)35-6-8-37(51-35)45(32-17-25-49-26-18-32)39-10-12-41(46)53-39;/h5-26,28-29H,2-4,27H2,1H3,(H,50,51,52,53);1H |
| InChIKey | RLNPNKBIAHCHGV-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 126.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.76 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|