C21H21F2N5 — CID 137250654
3-[4-(1,1-difluoroethyl)anilino]-5-methyl-N'-(1-phenylethenyl)-1H-pyrazole-4-carboximidamide (PubChem CID 137250654) has the molecular formula C21H21F2N5 and a molecular weight of 381.43 g/mol. Its IUPAC name is 3-[4-(1,1-difluoroethyl)anilino]-5-methyl-N'-(1-phenylethenyl)-1H-pyrazole-4-carboximidamide.
| Compound Name | 3-[4-(1,1-difluoroethyl)anilino]-5-methyl-N'-(1-phenylethenyl)-1H-pyrazole-4-carboximidamide |
|---|---|
| PubChem CID | 137250654 |
| Molecular Formula | C21H21F2N5 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | 3-[4-(1,1-difluoroethyl)anilino]-5-methyl-N'-(1-phenylethenyl)-1H-pyrazole-4-carboximidamide |
| SMILES | C=C(/N=C(\N)c1c(Nc2ccc(C(C)(F)F)cc2)n[nH]c1C)c1ccccc1 |
| InChI | InChI=1S/C21H21F2N5/c1-13(15-7-5-4-6-8-15)25-19(24)18-14(2)27-28-20(18)26-17-11-9-16(10-12-17)21(3,22)23/h4-12H,1H2,2-3H3,(H2,24,25)(H2,26,27,28) |
| InChIKey | SJSINLIOSZPRRA-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 79.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|