C12H10IN7O2 — CID 137250727
4-[6-iodo-5-[(2-methylphenoxy)methyl]triazin-4-yl]-1H-tetrazol-5-one (PubChem CID 137250727) has the molecular formula C12H10IN7O2 and a molecular weight of 411.16 g/mol. Its IUPAC name is 4-[6-iodo-5-[(2-methylphenoxy)methyl]triazin-4-yl]-1H-tetrazol-5-one.
| Compound Name | 4-[6-iodo-5-[(2-methylphenoxy)methyl]triazin-4-yl]-1H-tetrazol-5-one |
|---|---|
| PubChem CID | 137250727 |
| Molecular Formula | C12H10IN7O2 |
| Molecular Weight | 411.16 g/mol |
| Exact Mass | 410.99 |
| IUPAC Name | 4-[6-iodo-5-[(2-methylphenoxy)methyl]triazin-4-yl]-1H-tetrazol-5-one |
| SMILES | Cc1ccccc1OCc1c(I)nnnc1-n1nn[nH]c1=O |
| InChI | InChI=1S/C12H10IN7O2/c1-7-4-2-3-5-9(7)22-6-8-10(13)14-17-15-11(8)20-12(21)16-18-19-20/h2-5H,6H2,1H3,(H,16,19,21) |
| InChIKey | BIPCDHOZKCWJPM-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 111.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.16 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|