C17H24N6 — CID 137250772
4-butylimino-9-(1-methylpyrazol-4-yl)-1,3-diazaspiro[5.5]undeca-1,8,10-trien-2-amine (PubChem CID 137250772) has the molecular formula C17H24N6 and a molecular weight of 312.42 g/mol. Its IUPAC name is 4-butylimino-9-(1-methylpyrazol-4-yl)-1,3-diazaspiro[5.5]undeca-1,8,10-trien-2-amine.
| Compound Name | 4-butylimino-9-(1-methylpyrazol-4-yl)-1,3-diazaspiro[5.5]undeca-1,8,10-trien-2-amine |
|---|---|
| PubChem CID | 137250772 |
| Molecular Formula | C17H24N6 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | 4-butylimino-9-(1-methylpyrazol-4-yl)-1,3-diazaspiro[5.5]undeca-1,8,10-trien-2-amine |
| SMILES | CCCC/N=C1\CC2(C=CC(c3cnn(C)c3)=CC2)N=C(N)N1 |
| InChI | InChI=1S/C17H24N6/c1-3-4-9-19-15-10-17(22-16(18)21-15)7-5-13(6-8-17)14-11-20-23(2)12-14/h5-7,11-12H,3-4,8-10H2,1-2H3,(H3,18,19,21,22) |
| InChIKey | VXGSZNKJPPOKTN-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|