C18H14N6 — CID 137251453
1-(1H-imidazol-5-yl)-N-[5-(1H-imidazol-5-ylmethylideneamino)naphthalen-1-yl]methanimine (PubChem CID 137251453) has the molecular formula C18H14N6 and a molecular weight of 314.35 g/mol. Its IUPAC name is 1-(1H-imidazol-5-yl)-N-[5-(1H-imidazol-5-ylmethylideneamino)naphthalen-1-yl]methanimine.
| Compound Name | 1-(1H-imidazol-5-yl)-N-[5-(1H-imidazol-5-ylmethylideneamino)naphthalen-1-yl]methanimine |
|---|---|
| PubChem CID | 137251453 |
| Molecular Formula | C18H14N6 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 1-(1H-imidazol-5-yl)-N-[5-(1H-imidazol-5-ylmethylideneamino)naphthalen-1-yl]methanimine |
| SMILES | C(=N/c1cccc2c(/N=C/c3cnc[nH]3)cccc12)\c1cnc[nH]1 |
| InChI | InChI=1S/C18H14N6/c1-3-15-16(17(5-1)21-9-13-7-19-11-23-13)4-2-6-18(15)22-10-14-8-20-12-24-14/h1-12H,(H,19,23)(H,20,24)/b21-9+,22-10+ |
| InChIKey | OJARWDVSQAIHHH-VGENTYGXSA-N |
| XLogP | 3.79 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|