C22H33ClN6O6 — CID 137251728
tert-butyl 4-[3-[N-hydroxy-N-(4-methoxybutanoyl)carbamimidoyl]-5-oxo-4H-pyrazolo[1,5-a]pyrimidin-7-yl]piperidine-1-carboxylate;hydrochloride (PubChem CID 137251728) has the molecular formula C22H33ClN6O6 and a molecular weight of 513.00 g/mol. Its IUPAC name is tert-butyl 4-[3-[N-hydroxy-N-(4-methoxybutanoyl)carbamimidoyl]-5-oxo-4H-pyrazolo[1,5-a]pyrimidin-7-yl]piperidine-1-carboxylate;hydrochloride.
| Compound Name | tert-butyl 4-[3-[N-hydroxy-N-(4-methoxybutanoyl)carbamimidoyl]-5-oxo-4H-pyrazolo[1,5-a]pyrimidin-7-yl]piperidine-1-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 137251728 |
| Molecular Formula | C22H33ClN6O6 |
| Molecular Weight | 513.00 g/mol |
| Exact Mass | 512.22 |
| IUPAC Name | tert-butyl 4-[3-[N-hydroxy-N-(4-methoxybutanoyl)carbamimidoyl]-5-oxo-4H-pyrazolo[1,5-a]pyrimidin-7-yl]piperidine-1-carboxylate;hydrochloride |
| SMILES | Cl.[H]/N=C(/c1cnn2c(C3CCN(C(=O)OC(C)(C)C)CC3)cc(=O)[nH]c12)N(O)C(=O)CCCOC |
| InChI | InChI=1S/C22H32N6O6.ClH/c1-22(2,3)34-21(31)26-9-7-14(8-10-26)16-12-17(29)25-20-15(13-24-27(16)20)19(23)28(32)18(30)6-5-11-33-4;/h12-14,23,32H,5-11H2,1-4H3,(H,25,29);1H/b23-19-; |
| InChIKey | VAOYDQPXPHVNKH-PDEWKSAASA-N |
| XLogP | 2.53 |
| TPSA | 153.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.00 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|