About 3-(4-methylthiophen-2-yl)-7-piperidin-4-yl-4H-pyrazolo[1,5-a]pyrimidin-5-one;hydrochloride
3-(4-methylthiophen-2-yl)-7-piperidin-4-yl-4H-pyrazolo[1,5-a]pyrimidin-5-one;hydrochloride (PubChem CID 137251815) has the molecular formula C16H19ClN4OS
and a molecular weight of 350.88 g/mol. Its IUPAC name is 3-(4-methylthiophen-2-yl)-7-piperidin-4-yl-4H-pyrazolo[1,5-a]pyrimidin-5-one;hydrochloride.
Molecular Properties
| Compound Name | 3-(4-methylthiophen-2-yl)-7-piperidin-4-yl-4H-pyrazolo[1,5-a]pyrimidin-5-one;hydrochloride |
| PubChem CID | 137251815 |
| Molecular Formula | C16H19ClN4OS |
| Molecular Weight | 350.88 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 3-(4-methylthiophen-2-yl)-7-piperidin-4-yl-4H-pyrazolo[1,5-a]pyrimidin-5-one;hydrochloride |
| SMILES | Cc1csc(-c2cnn3c(C4CCNCC4)cc(=O)[nH]c23)c1.Cl |
| InChI | InChI=1S/C16H18N4OS.ClH/c1-10-6-14(22-9-10)12-8-18-20-13(7-15(21)19-16(12)20)11-2-4-17-5-3-11;/h6-9,11,17H,2-5H2,1H3,(H,19,21);1H |
| InChIKey | LWKMFMDMWKEKNR-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.88 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(4-methylthiophen-2-yl)-7-piperidin-4-yl-4H-pyrazolo[1,5-a]pyrimidin-5-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-methylthiophen-2-yl)-7-piperidin-4-yl-4H-pyrazolo[1,5-a]pyrimidin-5-one;hydrochloride?
The IUPAC name of 3-(4-methylthiophen-2-yl)-7-piperidin-4-yl-4H-pyrazolo[1,5-a]pyrimidin-5-one;hydrochloride (CID 137251815) is 3-(4-methylthiophen-2-yl)-7-piperidin-4-yl-4H-pyrazolo[1,5-a]pyrimidin-5-one;hydrochloride.
What is the SMILES notation for 3-(4-methylthiophen-2-yl)-7-piperidin-4-yl-4H-pyrazolo[1,5-a]pyrimidin-5-one;hydrochloride?
The canonical SMILES for 3-(4-methylthiophen-2-yl)-7-piperidin-4-yl-4H-pyrazolo[1,5-a]pyrimidin-5-one;hydrochloride is Cc1csc(-c2cnn3c(C4CCNCC4)cc(=O)[nH]c23)c1.Cl.
What is the InChIKey of 3-(4-methylthiophen-2-yl)-7-piperidin-4-yl-4H-pyrazolo[1,5-a]pyrimidin-5-one;hydrochloride?
The InChIKey is LWKMFMDMWKEKNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N4OS.ClH/c1-10-6-14(22-9-10)12-8-18-20-13(7-15(21)19-16(12)20)11-2-4-17-5-3-11;/h6-9,11,17H,2-5H2,1H3,(H,19,21);1H.
What are the key properties of 3-(4-methylthiophen-2-yl)-7-piperidin-4-yl-4H-pyrazolo[1,5-a]pyrimidin-5-one;hydrochloride?
3-(4-methylthiophen-2-yl)-7-piperidin-4-yl-4H-pyrazolo[1,5-a]pyrimidin-5-one;hydrochloride has a molecular weight of 350.88 g/mol, XLogP of 2.95, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methylthiophen-2-yl)-7-piperidin-4-yl-4H-pyrazolo[1,5-a]pyrimidin-5-one;hydrochloride is sourced from PubChem (CID 137251815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).