About 7-methyl-1,7-dihydropyrrolo[3,2-b]azepine
7-methyl-1,7-dihydropyrrolo[3,2-b]azepine (PubChem CID 137252694) has the molecular formula C9H10N2
and a molecular weight of 146.19 g/mol. Its IUPAC name is 7-methyl-1,7-dihydropyrrolo[3,2-b]azepine.
Molecular Properties
| Compound Name | 7-methyl-1,7-dihydropyrrolo[3,2-b]azepine |
| PubChem CID | 137252694 |
| Molecular Formula | C9H10N2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.08 |
| IUPAC Name | 7-methyl-1,7-dihydropyrrolo[3,2-b]azepine |
| SMILES | CC1C=CN=c2cc[nH]c2=C1 |
| InChI | InChI=1S/C9H10N2/c1-7-2-4-10-8-3-5-11-9(8)6-7/h2-7,11H,1H3 |
| InChIKey | FFUKERCGCVJGEF-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 28.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-methyl-1,7-dihydropyrrolo[3,2-b]azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-1,7-dihydropyrrolo[3,2-b]azepine?
The IUPAC name of 7-methyl-1,7-dihydropyrrolo[3,2-b]azepine (CID 137252694) is 7-methyl-1,7-dihydropyrrolo[3,2-b]azepine.
What is the SMILES notation for 7-methyl-1,7-dihydropyrrolo[3,2-b]azepine?
The canonical SMILES for 7-methyl-1,7-dihydropyrrolo[3,2-b]azepine is CC1C=CN=c2cc[nH]c2=C1.
What is the InChIKey of 7-methyl-1,7-dihydropyrrolo[3,2-b]azepine?
The InChIKey is FFUKERCGCVJGEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2/c1-7-2-4-10-8-3-5-11-9(8)6-7/h2-7,11H,1H3.
What are the key properties of 7-methyl-1,7-dihydropyrrolo[3,2-b]azepine?
7-methyl-1,7-dihydropyrrolo[3,2-b]azepine has a molecular weight of 146.19 g/mol, XLogP of 0.58, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-1,7-dihydropyrrolo[3,2-b]azepine is sourced from PubChem (CID 137252694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).